C29H26N2O4 — CID 58508644
tert-butyl 2-[(2-hydroxy-5-pyridin-3-ylbenzoyl)amino]-4-phenylbenzoate (PubChem CID 58508644) has the molecular formula C29H26N2O4 and a molecular weight of 466.54 g/mol. Its IUPAC name is tert-butyl 2-[(2-hydroxy-5-pyridin-3-ylbenzoyl)amino]-4-phenylbenzoate.
| Compound Name | tert-butyl 2-[(2-hydroxy-5-pyridin-3-ylbenzoyl)amino]-4-phenylbenzoate |
|---|---|
| PubChem CID | 58508644 |
| Molecular Formula | C29H26N2O4 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | tert-butyl 2-[(2-hydroxy-5-pyridin-3-ylbenzoyl)amino]-4-phenylbenzoate |
| SMILES | CC(C)(C)OC(=O)c1ccc(-c2ccccc2)cc1NC(=O)c1cc(-c2cccnc2)ccc1O |
| InChI | InChI=1S/C29H26N2O4/c1-29(2,3)35-28(34)23-13-11-21(19-8-5-4-6-9-19)17-25(23)31-27(33)24-16-20(12-14-26(24)32)22-10-7-15-30-18-22/h4-18,32H,1-3H3,(H,31,33) |
| InChIKey | DKXOPRIJOKXPSP-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |