C27H30N2O3 — CID 58508662
tert-butyl 2-[[4-(dimethylamino)-2-methylbenzoyl]amino]-4-phenylbenzoate (PubChem CID 58508662) has the molecular formula C27H30N2O3 and a molecular weight of 430.55 g/mol. Its IUPAC name is tert-butyl 2-[[4-(dimethylamino)-2-methylbenzoyl]amino]-4-phenylbenzoate.
| Compound Name | tert-butyl 2-[[4-(dimethylamino)-2-methylbenzoyl]amino]-4-phenylbenzoate |
|---|---|
| PubChem CID | 58508662 |
| Molecular Formula | C27H30N2O3 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | tert-butyl 2-[[4-(dimethylamino)-2-methylbenzoyl]amino]-4-phenylbenzoate |
| SMILES | Cc1cc(N(C)C)ccc1C(=O)Nc1cc(-c2ccccc2)ccc1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H30N2O3/c1-18-16-21(29(5)6)13-15-22(18)25(30)28-24-17-20(19-10-8-7-9-11-19)12-14-23(24)26(31)32-27(2,3)4/h7-17H,1-6H3,(H,28,30) |
| InChIKey | HCSMTXPLINKTRD-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |