C29H30FNO6 — CID 67342396
tert-butyl 2-[(4-fluorobenzoyl)amino]-4-[4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]benzoate (PubChem CID 67342396) has the molecular formula C29H30FNO6 and a molecular weight of 507.56 g/mol. Its IUPAC name is tert-butyl 2-[(4-fluorobenzoyl)amino]-4-[4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]benzoate.
| Compound Name | tert-butyl 2-[(4-fluorobenzoyl)amino]-4-[4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]benzoate |
|---|---|
| PubChem CID | 67342396 |
| Molecular Formula | C29H30FNO6 |
| Molecular Weight | 507.56 g/mol |
| Exact Mass | 507.21 |
| IUPAC Name | tert-butyl 2-[(4-fluorobenzoyl)amino]-4-[4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]benzoate |
| SMILES | CC(C)(C)OC(=O)Oc1ccc(-c2ccc(C(=O)OC(C)(C)C)c(NC(=O)c3ccc(F)cc3)c2)cc1 |
| InChI | InChI=1S/C29H30FNO6/c1-28(2,3)36-26(33)23-16-11-20(17-24(23)31-25(32)19-7-12-21(30)13-8-19)18-9-14-22(15-10-18)35-27(34)37-29(4,5)6/h7-17H,1-6H3,(H,31,32) |
| InChIKey | RYNBGJJLTHCAPX-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.56 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|