C26H22FNO4 — CID 67344778
tert-butyl 4-(1-benzofuran-2-yl)-2-[(4-fluorobenzoyl)amino]benzoate (PubChem CID 67344778) has the molecular formula C26H22FNO4 and a molecular weight of 431.46 g/mol. Its IUPAC name is tert-butyl 4-(1-benzofuran-2-yl)-2-[(4-fluorobenzoyl)amino]benzoate.
| Compound Name | tert-butyl 4-(1-benzofuran-2-yl)-2-[(4-fluorobenzoyl)amino]benzoate |
|---|---|
| PubChem CID | 67344778 |
| Molecular Formula | C26H22FNO4 |
| Molecular Weight | 431.46 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | tert-butyl 4-(1-benzofuran-2-yl)-2-[(4-fluorobenzoyl)amino]benzoate |
| SMILES | CC(C)(C)OC(=O)c1ccc(-c2cc3ccccc3o2)cc1NC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C26H22FNO4/c1-26(2,3)32-25(30)20-13-10-18(23-15-17-6-4-5-7-22(17)31-23)14-21(20)28-24(29)16-8-11-19(27)12-9-16/h4-15H,1-3H3,(H,28,29) |
| InChIKey | URWBXZPURRPLTE-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.46 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |