C27H26FNO4 — CID 67342390
tert-butyl 2-[(4-fluorobenzoyl)amino]-4-[(E)-2-(3-methoxyphenyl)ethenyl]benzoate (PubChem CID 67342390) has the molecular formula C27H26FNO4 and a molecular weight of 447.51 g/mol. Its IUPAC name is tert-butyl 2-[(4-fluorobenzoyl)amino]-4-[(E)-2-(3-methoxyphenyl)ethenyl]benzoate.
| Compound Name | tert-butyl 2-[(4-fluorobenzoyl)amino]-4-[(E)-2-(3-methoxyphenyl)ethenyl]benzoate |
|---|---|
| PubChem CID | 67342390 |
| Molecular Formula | C27H26FNO4 |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | tert-butyl 2-[(4-fluorobenzoyl)amino]-4-[(E)-2-(3-methoxyphenyl)ethenyl]benzoate |
| SMILES | COc1cccc(/C=C/c2ccc(C(=O)OC(C)(C)C)c(NC(=O)c3ccc(F)cc3)c2)c1 |
| InChI | InChI=1S/C27H26FNO4/c1-27(2,3)33-26(31)23-15-10-19(9-8-18-6-5-7-22(16-18)32-4)17-24(23)29-25(30)20-11-13-21(28)14-12-20/h5-17H,1-4H3,(H,29,30)/b9-8+ |
| InChIKey | GZWRDUROQFJBQT-CMDGGOBGSA-N |
| XLogP | 6.21 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|