C29H31NO4 — CID 67344207
tert-butyl 2-[(2,3-dimethylbenzoyl)amino]-4-[(E)-2-(3-methoxyphenyl)ethenyl]benzoate (PubChem CID 67344207) has the molecular formula C29H31NO4 and a molecular weight of 457.57 g/mol. Its IUPAC name is tert-butyl 2-[(2,3-dimethylbenzoyl)amino]-4-[(E)-2-(3-methoxyphenyl)ethenyl]benzoate.
| Compound Name | tert-butyl 2-[(2,3-dimethylbenzoyl)amino]-4-[(E)-2-(3-methoxyphenyl)ethenyl]benzoate |
|---|---|
| PubChem CID | 67344207 |
| Molecular Formula | C29H31NO4 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.23 |
| IUPAC Name | tert-butyl 2-[(2,3-dimethylbenzoyl)amino]-4-[(E)-2-(3-methoxyphenyl)ethenyl]benzoate |
| SMILES | COc1cccc(/C=C/c2ccc(C(=O)OC(C)(C)C)c(NC(=O)c3cccc(C)c3C)c2)c1 |
| InChI | InChI=1S/C29H31NO4/c1-19-9-7-12-24(20(19)2)27(31)30-26-18-22(14-13-21-10-8-11-23(17-21)33-6)15-16-25(26)28(32)34-29(3,4)5/h7-18H,1-6H3,(H,30,31)/b14-13+ |
| InChIKey | MJPSWJUTLWVDOY-BUHFOSPRSA-N |
| XLogP | 6.69 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|