C28H26N2O4 — CID 67343578
tert-butyl 2-benzamido-4-[2-(2-oxo-1,3-dihydroindol-6-yl)ethenyl]benzoate (PubChem CID 67343578) has the molecular formula C28H26N2O4 and a molecular weight of 454.53 g/mol. Its IUPAC name is tert-butyl 2-benzamido-4-[2-(2-oxo-1,3-dihydroindol-6-yl)ethenyl]benzoate.
| Compound Name | tert-butyl 2-benzamido-4-[2-(2-oxo-1,3-dihydroindol-6-yl)ethenyl]benzoate |
|---|---|
| PubChem CID | 67343578 |
| Molecular Formula | C28H26N2O4 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | tert-butyl 2-benzamido-4-[2-(2-oxo-1,3-dihydroindol-6-yl)ethenyl]benzoate |
| SMILES | CC(C)(C)OC(=O)c1ccc(C=Cc2ccc3c(c2)NC(=O)C3)cc1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C28H26N2O4/c1-28(2,3)34-27(33)22-14-12-19(16-24(22)30-26(32)20-7-5-4-6-8-20)10-9-18-11-13-21-17-25(31)29-23(21)15-18/h4-16H,17H2,1-3H3,(H,29,31)(H,30,32) |
| InChIKey | FFAQBCAVYRCVQN-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|