C27H23N3O3 — CID 66990541
4-[3-(dimethylamino)phenyl]-2-[(5-phenylpyridine-3-carbonyl)amino]benzoic acid (PubChem CID 66990541) has the molecular formula C27H23N3O3 and a molecular weight of 437.50 g/mol. Its IUPAC name is 4-[3-(dimethylamino)phenyl]-2-[(5-phenylpyridine-3-carbonyl)amino]benzoic acid.
| Compound Name | 4-[3-(dimethylamino)phenyl]-2-[(5-phenylpyridine-3-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 66990541 |
| Molecular Formula | C27H23N3O3 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | 4-[3-(dimethylamino)phenyl]-2-[(5-phenylpyridine-3-carbonyl)amino]benzoic acid |
| SMILES | CN(C)c1cccc(-c2ccc(C(=O)O)c(NC(=O)c3cncc(-c4ccccc4)c3)c2)c1 |
| InChI | InChI=1S/C27H23N3O3/c1-30(2)23-10-6-9-19(14-23)20-11-12-24(27(32)33)25(15-20)29-26(31)22-13-21(16-28-17-22)18-7-4-3-5-8-18/h3-17H,1-2H3,(H,29,31)(H,32,33) |
| InChIKey | UKWQVFVMUJKAGY-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |