C25H25NO4 — CID 68959355
tert-butyl 2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-4-phenylbenzoate (PubChem CID 68959355) has the molecular formula C25H25NO4 and a molecular weight of 403.48 g/mol. Its IUPAC name is tert-butyl 2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-4-phenylbenzoate.
| Compound Name | tert-butyl 2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-4-phenylbenzoate |
|---|---|
| PubChem CID | 68959355 |
| Molecular Formula | C25H25NO4 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | tert-butyl 2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-4-phenylbenzoate |
| SMILES | CC(C)(C)OC(=O)c1ccc(-c2ccccc2)cc1Nc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C25H25NO4/c1-25(2,3)30-24(27)20-11-9-18(17-7-5-4-6-8-17)15-21(20)26-19-10-12-22-23(16-19)29-14-13-28-22/h4-12,15-16,26H,13-14H2,1-3H3 |
| InChIKey | NYIYSPFDTLKWAO-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |