C23H18N2O3 — CID 70668755
N-[5-(furan-2-yl)-2-methylphenyl]-2-hydroxy-5-pyridin-3-ylbenzamide (PubChem CID 70668755) has the molecular formula C23H18N2O3 and a molecular weight of 370.41 g/mol. Its IUPAC name is N-[5-(furan-2-yl)-2-methylphenyl]-2-hydroxy-5-pyridin-3-ylbenzamide.
| Compound Name | N-[5-(furan-2-yl)-2-methylphenyl]-2-hydroxy-5-pyridin-3-ylbenzamide |
|---|---|
| PubChem CID | 70668755 |
| Molecular Formula | C23H18N2O3 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | N-[5-(furan-2-yl)-2-methylphenyl]-2-hydroxy-5-pyridin-3-ylbenzamide |
| SMILES | Cc1ccc(-c2ccco2)cc1NC(=O)c1cc(-c2cccnc2)ccc1O |
| InChI | InChI=1S/C23H18N2O3/c1-15-6-7-17(22-5-3-11-28-22)13-20(15)25-23(27)19-12-16(8-9-21(19)26)18-4-2-10-24-14-18/h2-14,26H,1H3,(H,25,27) |
| InChIKey | PHDKPKWMSTVTCC-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |