C22H17FN4O — CID 166222014
3-(4-fluorophenyl)-N-(2-methyl-5-pyridin-3-ylphenyl)imidazole-4-carboxamide (PubChem CID 166222014) has the molecular formula C22H17FN4O and a molecular weight of 372.40 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-N-(2-methyl-5-pyridin-3-ylphenyl)imidazole-4-carboxamide.
| Compound Name | 3-(4-fluorophenyl)-N-(2-methyl-5-pyridin-3-ylphenyl)imidazole-4-carboxamide |
|---|---|
| PubChem CID | 166222014 |
| Molecular Formula | C22H17FN4O |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 3-(4-fluorophenyl)-N-(2-methyl-5-pyridin-3-ylphenyl)imidazole-4-carboxamide |
| SMILES | Cc1ccc(-c2cccnc2)cc1NC(=O)c1cncn1-c1ccc(F)cc1 |
| InChI | InChI=1S/C22H17FN4O/c1-15-4-5-16(17-3-2-10-24-12-17)11-20(15)26-22(28)21-13-25-14-27(21)19-8-6-18(23)7-9-19/h2-14H,1H3,(H,26,28) |
| InChIKey | BKKOTRLJFRMDJX-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |