C21H15F2N5O — CID 53125173
N-(4-fluoro-2-methylphenyl)-1-(4-fluorophenyl)-5-pyridin-3-yltriazole-4-carboxamide (PubChem CID 53125173) has the molecular formula C21H15F2N5O and a molecular weight of 391.38 g/mol. Its IUPAC name is N-(4-fluoro-2-methylphenyl)-1-(4-fluorophenyl)-5-pyridin-3-yltriazole-4-carboxamide.
| Compound Name | N-(4-fluoro-2-methylphenyl)-1-(4-fluorophenyl)-5-pyridin-3-yltriazole-4-carboxamide |
|---|---|
| PubChem CID | 53125173 |
| Molecular Formula | C21H15F2N5O |
| Molecular Weight | 391.38 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | N-(4-fluoro-2-methylphenyl)-1-(4-fluorophenyl)-5-pyridin-3-yltriazole-4-carboxamide |
| SMILES | Cc1cc(F)ccc1NC(=O)c1nnn(-c2ccc(F)cc2)c1-c1cccnc1 |
| InChI | InChI=1S/C21H15F2N5O/c1-13-11-16(23)6-9-18(13)25-21(29)19-20(14-3-2-10-24-12-14)28(27-26-19)17-7-4-15(22)5-8-17/h2-12H,1H3,(H,25,29) |
| InChIKey | SUNARRYBQXFJEA-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.38 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |