C22H19N5OS — CID 53125258
N-benzyl-1-(4-methylsulfanylphenyl)-5-pyridin-3-yltriazole-4-carboxamide (PubChem CID 53125258) has the molecular formula C22H19N5OS and a molecular weight of 401.50 g/mol. Its IUPAC name is N-benzyl-1-(4-methylsulfanylphenyl)-5-pyridin-3-yltriazole-4-carboxamide.
| Compound Name | N-benzyl-1-(4-methylsulfanylphenyl)-5-pyridin-3-yltriazole-4-carboxamide |
|---|---|
| PubChem CID | 53125258 |
| Molecular Formula | C22H19N5OS |
| Molecular Weight | 401.50 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | N-benzyl-1-(4-methylsulfanylphenyl)-5-pyridin-3-yltriazole-4-carboxamide |
| SMILES | CSc1ccc(-n2nnc(C(=O)NCc3ccccc3)c2-c2cccnc2)cc1 |
| InChI | InChI=1S/C22H19N5OS/c1-29-19-11-9-18(10-12-19)27-21(17-8-5-13-23-15-17)20(25-26-27)22(28)24-14-16-6-3-2-4-7-16/h2-13,15H,14H2,1H3,(H,24,28) |
| InChIKey | GFSKLWZTWBFLDK-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.50 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |