C21H15ClFN5O — CID 53125141
N-[(4-chlorophenyl)methyl]-1-(4-fluorophenyl)-5-pyridin-3-yltriazole-4-carboxamide (PubChem CID 53125141) has the molecular formula C21H15ClFN5O and a molecular weight of 407.84 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-1-(4-fluorophenyl)-5-pyridin-3-yltriazole-4-carboxamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-1-(4-fluorophenyl)-5-pyridin-3-yltriazole-4-carboxamide |
|---|---|
| PubChem CID | 53125141 |
| Molecular Formula | C21H15ClFN5O |
| Molecular Weight | 407.84 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-1-(4-fluorophenyl)-5-pyridin-3-yltriazole-4-carboxamide |
| SMILES | O=C(NCc1ccc(Cl)cc1)c1nnn(-c2ccc(F)cc2)c1-c1cccnc1 |
| InChI | InChI=1S/C21H15ClFN5O/c22-16-5-3-14(4-6-16)12-25-21(29)19-20(15-2-1-11-24-13-15)28(27-26-19)18-9-7-17(23)8-10-18/h1-11,13H,12H2,(H,25,29) |
| InChIKey | LDRFMCZEKGMTBB-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.84 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |