C22H18ClN5O — CID 53332549
1-(4-chlorophenyl)-N-[(3-methylphenyl)methyl]-5-pyridin-3-yltriazole-4-carboxamide (PubChem CID 53332549) has the molecular formula C22H18ClN5O and a molecular weight of 403.87 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-[(3-methylphenyl)methyl]-5-pyridin-3-yltriazole-4-carboxamide.
| Compound Name | 1-(4-chlorophenyl)-N-[(3-methylphenyl)methyl]-5-pyridin-3-yltriazole-4-carboxamide |
|---|---|
| PubChem CID | 53332549 |
| Molecular Formula | C22H18ClN5O |
| Molecular Weight | 403.87 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | 1-(4-chlorophenyl)-N-[(3-methylphenyl)methyl]-5-pyridin-3-yltriazole-4-carboxamide |
| SMILES | Cc1cccc(CNC(=O)c2nnn(-c3ccc(Cl)cc3)c2-c2cccnc2)c1 |
| InChI | InChI=1S/C22H18ClN5O/c1-15-4-2-5-16(12-15)13-25-22(29)20-21(17-6-3-11-24-14-17)28(27-26-20)19-9-7-18(23)8-10-19/h2-12,14H,13H2,1H3,(H,25,29) |
| InChIKey | NRYWIDDQZNFJQG-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.87 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |