C21H15BrClN5O — CID 53332540
N-[(3-bromophenyl)methyl]-1-(4-chlorophenyl)-5-pyridin-3-yltriazole-4-carboxamide (PubChem CID 53332540) has the molecular formula C21H15BrClN5O and a molecular weight of 468.74 g/mol. Its IUPAC name is N-[(3-bromophenyl)methyl]-1-(4-chlorophenyl)-5-pyridin-3-yltriazole-4-carboxamide.
| Compound Name | N-[(3-bromophenyl)methyl]-1-(4-chlorophenyl)-5-pyridin-3-yltriazole-4-carboxamide |
|---|---|
| PubChem CID | 53332540 |
| Molecular Formula | C21H15BrClN5O |
| Molecular Weight | 468.74 g/mol |
| Exact Mass | 467.01 |
| IUPAC Name | N-[(3-bromophenyl)methyl]-1-(4-chlorophenyl)-5-pyridin-3-yltriazole-4-carboxamide |
| SMILES | O=C(NCc1cccc(Br)c1)c1nnn(-c2ccc(Cl)cc2)c1-c1cccnc1 |
| InChI | InChI=1S/C21H15BrClN5O/c22-16-5-1-3-14(11-16)12-25-21(29)19-20(15-4-2-10-24-13-15)28(27-26-19)18-8-6-17(23)7-9-18/h1-11,13H,12H2,(H,25,29) |
| InChIKey | VWSZJBGXVRSXQY-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.74 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |