C23H38N2O6 — CID 54002784
N-[(2S)-2-[[(2S)-2-hydroxy-3-[4-(2-propoxyethoxy)phenoxy]propyl]amino]propyl]oxane-4-carboxamide (PubChem CID 54002784) has the molecular formula C23H38N2O6 and a molecular weight of 438.57 g/mol. Its IUPAC name is N-[(2S)-2-[[(2S)-2-hydroxy-3-[4-(2-propoxyethoxy)phenoxy]propyl]amino]propyl]oxane-4-carboxamide.
| Compound Name | N-[(2S)-2-[[(2S)-2-hydroxy-3-[4-(2-propoxyethoxy)phenoxy]propyl]amino]propyl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 54002784 |
| Molecular Formula | C23H38N2O6 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.27 |
| IUPAC Name | N-[(2S)-2-[[(2S)-2-hydroxy-3-[4-(2-propoxyethoxy)phenoxy]propyl]amino]propyl]oxane-4-carboxamide |
| SMILES | CCCOCCOc1ccc(OC[C@@H](O)CN[C@@H](C)CNC(=O)C2CCOCC2)cc1 |
| InChI | InChI=1S/C23H38N2O6/c1-3-10-28-13-14-30-21-4-6-22(7-5-21)31-17-20(26)16-24-18(2)15-25-23(27)19-8-11-29-12-9-19/h4-7,18-20,24,26H,3,8-17H2,1-2H3,(H,25,27)/t18-,20-/m0/s1 |
| InChIKey | KMUBWPRVDNJCND-ICSRJNTNSA-N |
| XLogP | 1.75 |
| TPSA | 98.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|