C28H39FN2O6 — CID 70388528
N-[(2S)-2-[[(2R)-3-[4-[2-[2-(4-fluorophenyl)ethoxy]ethoxy]phenoxy]-2-hydroxypropyl]amino]propyl]oxane-4-carboxamide (PubChem CID 70388528) has the molecular formula C28H39FN2O6 and a molecular weight of 518.63 g/mol. Its IUPAC name is N-[(2S)-2-[[(2R)-3-[4-[2-[2-(4-fluorophenyl)ethoxy]ethoxy]phenoxy]-2-hydroxypropyl]amino]propyl]oxane-4-carboxamide.
| Compound Name | N-[(2S)-2-[[(2R)-3-[4-[2-[2-(4-fluorophenyl)ethoxy]ethoxy]phenoxy]-2-hydroxypropyl]amino]propyl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 70388528 |
| Molecular Formula | C28H39FN2O6 |
| Molecular Weight | 518.63 g/mol |
| Exact Mass | 518.28 |
| IUPAC Name | N-[(2S)-2-[[(2R)-3-[4-[2-[2-(4-fluorophenyl)ethoxy]ethoxy]phenoxy]-2-hydroxypropyl]amino]propyl]oxane-4-carboxamide |
| SMILES | C[C@@H](CNC(=O)C1CCOCC1)NC[C@@H](O)COc1ccc(OCCOCCc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C28H39FN2O6/c1-21(18-31-28(33)23-11-14-34-15-12-23)30-19-25(32)20-37-27-8-6-26(7-9-27)36-17-16-35-13-10-22-2-4-24(29)5-3-22/h2-9,21,23,25,30,32H,10-20H2,1H3,(H,31,33)/t21-,25+/m0/s1 |
| InChIKey | LUIFFIGGAACBLN-SQJMNOBHSA-N |
| XLogP | 2.72 |
| TPSA | 98.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.63 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|