C14H21N3O2 — CID 93381176
4-[(2S)-3-[2-(dimethylamino)ethylamino]-2-hydroxypropoxy]benzonitrile (PubChem CID 93381176) has the molecular formula C14H21N3O2 and a molecular weight of 263.34 g/mol. Its IUPAC name is 4-[(2S)-3-[2-(dimethylamino)ethylamino]-2-hydroxypropoxy]benzonitrile.
| Compound Name | 4-[(2S)-3-[2-(dimethylamino)ethylamino]-2-hydroxypropoxy]benzonitrile |
|---|---|
| PubChem CID | 93381176 |
| Molecular Formula | C14H21N3O2 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.16 |
| IUPAC Name | 4-[(2S)-3-[2-(dimethylamino)ethylamino]-2-hydroxypropoxy]benzonitrile |
| SMILES | CN(C)CCNC[C@H](O)COc1ccc(C#N)cc1 |
| InChI | InChI=1S/C14H21N3O2/c1-17(2)8-7-16-10-13(18)11-19-14-5-3-12(9-15)4-6-14/h3-6,13,16,18H,7-8,10-11H2,1-2H3/t13-/m0/s1 |
| InChIKey | XNCBAIJOLWAXAH-ZDUSSCGKSA-N |
| XLogP | 0.45 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|