C14H20N2O3 — CID 65107302
4-[2-hydroxy-3-[(2-hydroxy-2-methylpropyl)amino]propoxy]benzonitrile (PubChem CID 65107302) has the molecular formula C14H20N2O3 and a molecular weight of 264.33 g/mol. Its IUPAC name is 4-[2-hydroxy-3-[(2-hydroxy-2-methylpropyl)amino]propoxy]benzonitrile.
| Compound Name | 4-[2-hydroxy-3-[(2-hydroxy-2-methylpropyl)amino]propoxy]benzonitrile |
|---|---|
| PubChem CID | 65107302 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 4-[2-hydroxy-3-[(2-hydroxy-2-methylpropyl)amino]propoxy]benzonitrile |
| SMILES | CC(C)(O)CNCC(O)COc1ccc(C#N)cc1 |
| InChI | InChI=1S/C14H20N2O3/c1-14(2,18)10-16-8-12(17)9-19-13-5-3-11(7-15)4-6-13/h3-6,12,16-18H,8-10H2,1-2H3 |
| InChIKey | WAEDEHYYPPRNML-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 85.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |