C22H29N3O6 — CID 20527571
1-[(6-amino-7-nitro-2,3-dihydro-1H-inden-5-yl)oxy]-3-[2-(3,4-dimethoxyphenyl)ethylamino]propan-2-ol (PubChem CID 20527571) has the molecular formula C22H29N3O6 and a molecular weight of 431.49 g/mol. Its IUPAC name is 1-[(6-amino-7-nitro-2,3-dihydro-1H-inden-5-yl)oxy]-3-[2-(3,4-dimethoxyphenyl)ethylamino]propan-2-ol.
| Compound Name | 1-[(6-amino-7-nitro-2,3-dihydro-1H-inden-5-yl)oxy]-3-[2-(3,4-dimethoxyphenyl)ethylamino]propan-2-ol |
|---|---|
| PubChem CID | 20527571 |
| Molecular Formula | C22H29N3O6 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | 1-[(6-amino-7-nitro-2,3-dihydro-1H-inden-5-yl)oxy]-3-[2-(3,4-dimethoxyphenyl)ethylamino]propan-2-ol |
| SMILES | COc1ccc(CCNCC(O)COc2cc3c(c([N+](=O)[O-])c2N)CCC3)cc1OC |
| InChI | InChI=1S/C22H29N3O6/c1-29-18-7-6-14(10-19(18)30-2)8-9-24-12-16(26)13-31-20-11-15-4-3-5-17(15)22(21(20)23)25(27)28/h6-7,10-11,16,24,26H,3-5,8-9,12-13,23H2,1-2H3 |
| InChIKey | DUVOWCKRYXYARX-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 129.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|