C26H35N3O7 — CID 20570412
4-[[5-[3-[2-(3,4-dimethoxyphenyl)ethylamino]-2-hydroxypropoxy]-2-oxo-3,4-dihydro-1H-quinolin-8-yl]oxy]butanamide (PubChem CID 20570412) has the molecular formula C26H35N3O7 and a molecular weight of 501.58 g/mol. Its IUPAC name is 4-[[5-[3-[2-(3,4-dimethoxyphenyl)ethylamino]-2-hydroxypropoxy]-2-oxo-3,4-dihydro-1H-quinolin-8-yl]oxy]butanamide.
| Compound Name | 4-[[5-[3-[2-(3,4-dimethoxyphenyl)ethylamino]-2-hydroxypropoxy]-2-oxo-3,4-dihydro-1H-quinolin-8-yl]oxy]butanamide |
|---|---|
| PubChem CID | 20570412 |
| Molecular Formula | C26H35N3O7 |
| Molecular Weight | 501.58 g/mol |
| Exact Mass | 501.25 |
| IUPAC Name | 4-[[5-[3-[2-(3,4-dimethoxyphenyl)ethylamino]-2-hydroxypropoxy]-2-oxo-3,4-dihydro-1H-quinolin-8-yl]oxy]butanamide |
| SMILES | COc1ccc(CCNCC(O)COc2ccc(OCCCC(N)=O)c3c2CCC(=O)N3)cc1OC |
| InChI | InChI=1S/C26H35N3O7/c1-33-21-7-5-17(14-23(21)34-2)11-12-28-15-18(30)16-36-20-8-9-22(35-13-3-4-24(27)31)26-19(20)6-10-25(32)29-26/h5,7-9,14,18,28,30H,3-4,6,10-13,15-16H2,1-2H3,(H2,27,31)(H,29,32) |
| InChIKey | PANSZRSWNWMAIA-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 141.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.58 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|