C22H27N5O6 — CID 21326387
4-[2-[[3-[[8-(carbamoylamino)-2-oxo-3,4-dihydro-1H-quinolin-5-yl]oxy]-2-hydroxypropyl]amino]ethoxy]benzamide (PubChem CID 21326387) has the molecular formula C22H27N5O6 and a molecular weight of 457.49 g/mol. Its IUPAC name is 4-[2-[[3-[[8-(carbamoylamino)-2-oxo-3,4-dihydro-1H-quinolin-5-yl]oxy]-2-hydroxypropyl]amino]ethoxy]benzamide.
| Compound Name | 4-[2-[[3-[[8-(carbamoylamino)-2-oxo-3,4-dihydro-1H-quinolin-5-yl]oxy]-2-hydroxypropyl]amino]ethoxy]benzamide |
|---|---|
| PubChem CID | 21326387 |
| Molecular Formula | C22H27N5O6 |
| Molecular Weight | 457.49 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | 4-[2-[[3-[[8-(carbamoylamino)-2-oxo-3,4-dihydro-1H-quinolin-5-yl]oxy]-2-hydroxypropyl]amino]ethoxy]benzamide |
| SMILES | NC(=O)Nc1ccc(OCC(O)CNCCOc2ccc(C(N)=O)cc2)c2c1NC(=O)CC2 |
| InChI | InChI=1S/C22H27N5O6/c23-21(30)13-1-3-15(4-2-13)32-10-9-25-11-14(28)12-33-18-7-6-17(26-22(24)31)20-16(18)5-8-19(29)27-20/h1-4,6-7,14,25,28H,5,8-12H2,(H2,23,30)(H,27,29)(H3,24,26,31) |
| InChIKey | GCHMCZNOHQYNAE-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 178.03 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.49 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|