C25H30N2O6 — CID 20570338
8-but-2-ynoxy-5-[2-hydroxy-3-[2-(4-methoxyphenoxy)ethylamino]propoxy]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 20570338) has the molecular formula C25H30N2O6 and a molecular weight of 454.52 g/mol. Its IUPAC name is 8-but-2-ynoxy-5-[2-hydroxy-3-[2-(4-methoxyphenoxy)ethylamino]propoxy]-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 8-but-2-ynoxy-5-[2-hydroxy-3-[2-(4-methoxyphenoxy)ethylamino]propoxy]-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 20570338 |
| Molecular Formula | C25H30N2O6 |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | 8-but-2-ynoxy-5-[2-hydroxy-3-[2-(4-methoxyphenoxy)ethylamino]propoxy]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | CC#CCOc1ccc(OCC(O)CNCCOc2ccc(OC)cc2)c2c1NC(=O)CC2 |
| InChI | InChI=1S/C25H30N2O6/c1-3-4-14-32-23-11-10-22(21-9-12-24(29)27-25(21)23)33-17-18(28)16-26-13-15-31-20-7-5-19(30-2)6-8-20/h5-8,10-11,18,26,28H,9,12-17H2,1-2H3,(H,27,29) |
| InChIKey | XFLKNVUARKZCPD-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 98.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|