C28H28N2O4 — CID 12925490
5-[3-(benzhydrylamino)-2-hydroxypropoxy]-8-prop-2-ynoxy-3,4-dihydro-1H-quinolin-2-one (PubChem CID 12925490) has the molecular formula C28H28N2O4 and a molecular weight of 456.54 g/mol. Its IUPAC name is 5-[3-(benzhydrylamino)-2-hydroxypropoxy]-8-prop-2-ynoxy-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 5-[3-(benzhydrylamino)-2-hydroxypropoxy]-8-prop-2-ynoxy-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 12925490 |
| Molecular Formula | C28H28N2O4 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | 5-[3-(benzhydrylamino)-2-hydroxypropoxy]-8-prop-2-ynoxy-3,4-dihydro-1H-quinolin-2-one |
| SMILES | C#CCOc1ccc(OCC(O)CNC(c2ccccc2)c2ccccc2)c2c1NC(=O)CC2 |
| InChI | InChI=1S/C28H28N2O4/c1-2-17-33-25-15-14-24(23-13-16-26(32)30-28(23)25)34-19-22(31)18-29-27(20-9-5-3-6-10-20)21-11-7-4-8-12-21/h1,3-12,14-15,22,27,29,31H,13,16-19H2,(H,30,32) |
| InChIKey | HKCSJBFKFCHKIM-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|