C24H31BrN2O6 — CID 54457993
5-[3-[4-(4-bromophenoxy)butylamino]-2-hydroxypropoxy]-8-(2-hydroxyethoxy)-3,4-dihydro-1H-quinolin-2-one (PubChem CID 54457993) has the molecular formula C24H31BrN2O6 and a molecular weight of 523.42 g/mol. Its IUPAC name is 5-[3-[4-(4-bromophenoxy)butylamino]-2-hydroxypropoxy]-8-(2-hydroxyethoxy)-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 5-[3-[4-(4-bromophenoxy)butylamino]-2-hydroxypropoxy]-8-(2-hydroxyethoxy)-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 54457993 |
| Molecular Formula | C24H31BrN2O6 |
| Molecular Weight | 523.42 g/mol |
| Exact Mass | 522.14 |
| IUPAC Name | 5-[3-[4-(4-bromophenoxy)butylamino]-2-hydroxypropoxy]-8-(2-hydroxyethoxy)-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2c(OCC(O)CNCCCCOc3ccc(Br)cc3)ccc(OCCO)c2N1 |
| InChI | InChI=1S/C24H31BrN2O6/c25-17-3-5-19(6-4-17)31-13-2-1-11-26-15-18(29)16-33-21-8-9-22(32-14-12-28)24-20(21)7-10-23(30)27-24/h3-6,8-9,18,26,28-29H,1-2,7,10-16H2,(H,27,30) |
| InChIKey | WZOITZZIOCJFPU-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 109.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.42 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|