C54H68N4O16 — CID 88771503
bis[1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-[[8-(2-methoxyethoxy)-2-oxo-3,4-dihydro-1H-quinolin-5-yl]oxy]propan-2-yl] (Z)-but-2-enedioate (PubChem CID 88771503) has the molecular formula C54H68N4O16 and a molecular weight of 1029.15 g/mol. Its IUPAC name is bis[1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-[[8-(2-methoxyethoxy)-2-oxo-3,4-dihydro-1H-quinolin-5-yl]oxy]propan-2-yl] (Z)-but-2-enedioate.
| Compound Name | bis[1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-[[8-(2-methoxyethoxy)-2-oxo-3,4-dihydro-1H-quinolin-5-yl]oxy]propan-2-yl] (Z)-but-2-enedioate |
|---|---|
| PubChem CID | 88771503 |
| Molecular Formula | C54H68N4O16 |
| Molecular Weight | 1029.15 g/mol |
| Exact Mass | 1028.46 |
| IUPAC Name | bis[1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-[[8-(2-methoxyethoxy)-2-oxo-3,4-dihydro-1H-quinolin-5-yl]oxy]propan-2-yl] (Z)-but-2-enedioate |
| SMILES | COCCOc1ccc(OCC(CNCCc2ccc(OC)c(OC)c2)OC(=O)/C=C\C(=O)OC(CNCCc2ccc(OC)c(OC)c2)COc2ccc(OCCOC)c3c2CCC(=O)N3)c2c1NC(=O)CC2 |
| InChI | InChI=1S/C54H68N4O16/c1-63-25-27-69-45-15-13-41(39-9-17-49(59)57-53(39)45)71-33-37(31-55-23-21-35-7-11-43(65-3)47(29-35)67-5)73-51(61)19-20-52(62)74-38(32-56-24-22-36-8-12-44(66-4)48(30-36)68-6)34-72-42-14-16-46(70-28-26-64-2)54-40(42)10-18-50(60)58-54/h7-8,11-16,19-20,29-30,37-38,55-56H,9-10,17-18,21-28,31-34H2,1-6H3,(H,57,59)(H,58,60)/b20-19- |
| InChIKey | GWVJOAJWCFUXBN-VXPUYCOJSA-N |
| XLogP | 5.04 |
| TPSA | 227.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 74 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1029.15 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|