C26H34N2O6 — CID 70581346
5-[3-[2-(3,4-dimethoxyphenyl)ethylamino]-2-hydroxypropoxy]-1-methyl-8-prop-2-enoxy-3,4-dihydroquinolin-2-one (PubChem CID 70581346) has the molecular formula C26H34N2O6 and a molecular weight of 470.57 g/mol. Its IUPAC name is 5-[3-[2-(3,4-dimethoxyphenyl)ethylamino]-2-hydroxypropoxy]-1-methyl-8-prop-2-enoxy-3,4-dihydroquinolin-2-one.
| Compound Name | 5-[3-[2-(3,4-dimethoxyphenyl)ethylamino]-2-hydroxypropoxy]-1-methyl-8-prop-2-enoxy-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 70581346 |
| Molecular Formula | C26H34N2O6 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.24 |
| IUPAC Name | 5-[3-[2-(3,4-dimethoxyphenyl)ethylamino]-2-hydroxypropoxy]-1-methyl-8-prop-2-enoxy-3,4-dihydroquinolin-2-one |
| SMILES | C=CCOc1ccc(OCC(O)CNCCc2ccc(OC)c(OC)c2)c2c1N(C)C(=O)CC2 |
| InChI | InChI=1S/C26H34N2O6/c1-5-14-33-23-10-9-21(20-7-11-25(30)28(2)26(20)23)34-17-19(29)16-27-13-12-18-6-8-22(31-3)24(15-18)32-4/h5-6,8-10,15,19,27,29H,1,7,11-14,16-17H2,2-4H3 |
| InChIKey | RXIXAFVJLMYHFP-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 89.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|