C23H30N2O7 — CID 20561362
5-[3-[1-(3,4-dimethoxyphenoxy)propan-2-ylamino]-2-hydroxypropoxy]-8-hydroxy-3,4-dihydro-1H-quinolin-2-one (PubChem CID 20561362) has the molecular formula C23H30N2O7 and a molecular weight of 446.50 g/mol. Its IUPAC name is 5-[3-[1-(3,4-dimethoxyphenoxy)propan-2-ylamino]-2-hydroxypropoxy]-8-hydroxy-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 5-[3-[1-(3,4-dimethoxyphenoxy)propan-2-ylamino]-2-hydroxypropoxy]-8-hydroxy-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 20561362 |
| Molecular Formula | C23H30N2O7 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | 5-[3-[1-(3,4-dimethoxyphenoxy)propan-2-ylamino]-2-hydroxypropoxy]-8-hydroxy-3,4-dihydro-1H-quinolin-2-one |
| SMILES | COc1ccc(OCC(C)NCC(O)COc2ccc(O)c3c2CCC(=O)N3)cc1OC |
| InChI | InChI=1S/C23H30N2O7/c1-14(12-31-16-4-7-20(29-2)21(10-16)30-3)24-11-15(26)13-32-19-8-6-18(27)23-17(19)5-9-22(28)25-23/h4,6-8,10,14-15,24,26-27H,5,9,11-13H2,1-3H3,(H,25,28) |
| InChIKey | LJOWDARFTYVNQW-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 118.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|