C20H27NO4 — CID 102417589
1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-phenylmethoxypropan-2-ol (PubChem CID 102417589) has the molecular formula C20H27NO4 and a molecular weight of 345.44 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-phenylmethoxypropan-2-ol.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-phenylmethoxypropan-2-ol |
|---|---|
| PubChem CID | 102417589 |
| Molecular Formula | C20H27NO4 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-phenylmethoxypropan-2-ol |
| SMILES | COc1ccc(CCNCC(O)COCc2ccccc2)cc1OC |
| InChI | InChI=1S/C20H27NO4/c1-23-19-9-8-16(12-20(19)24-2)10-11-21-13-18(22)15-25-14-17-6-4-3-5-7-17/h3-9,12,18,21-22H,10-11,13-15H2,1-2H3 |
| InChIKey | YADCBUUITBECGK-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|