C17H30N2O4 — CID 2082356
(2S)-1-[(3,4-dimethoxyphenyl)methoxy]-3-[3-(dimethylamino)propylamino]propan-2-ol (PubChem CID 2082356) has the molecular formula C17H30N2O4 and a molecular weight of 326.44 g/mol. Its IUPAC name is (2S)-1-[(3,4-dimethoxyphenyl)methoxy]-3-[3-(dimethylamino)propylamino]propan-2-ol.
| Compound Name | (2S)-1-[(3,4-dimethoxyphenyl)methoxy]-3-[3-(dimethylamino)propylamino]propan-2-ol |
|---|---|
| PubChem CID | 2082356 |
| Molecular Formula | C17H30N2O4 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | (2S)-1-[(3,4-dimethoxyphenyl)methoxy]-3-[3-(dimethylamino)propylamino]propan-2-ol |
| SMILES | COc1ccc(COC[C@@H](O)CNCCCN(C)C)cc1OC |
| InChI | InChI=1S/C17H30N2O4/c1-19(2)9-5-8-18-11-15(20)13-23-12-14-6-7-16(21-3)17(10-14)22-4/h6-7,10,15,18,20H,5,8-9,11-13H2,1-4H3/t15-/m0/s1 |
| InChIKey | HQDYRBIXZRDNFE-HNNXBMFYSA-N |
| XLogP | 1.12 |
| TPSA | 63.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|