C21H38O5Si — CID 67253770
1-[(3,4-dimethoxyphenyl)methoxy]-3-tri(propan-2-yl)silyloxypropan-2-ol (PubChem CID 67253770) has the molecular formula C21H38O5Si and a molecular weight of 398.62 g/mol. Its IUPAC name is 1-[(3,4-dimethoxyphenyl)methoxy]-3-tri(propan-2-yl)silyloxypropan-2-ol.
| Compound Name | 1-[(3,4-dimethoxyphenyl)methoxy]-3-tri(propan-2-yl)silyloxypropan-2-ol |
|---|---|
| PubChem CID | 67253770 |
| Molecular Formula | C21H38O5Si |
| Molecular Weight | 398.62 g/mol |
| Exact Mass | 398.25 |
| IUPAC Name | 1-[(3,4-dimethoxyphenyl)methoxy]-3-tri(propan-2-yl)silyloxypropan-2-ol |
| SMILES | COc1ccc(COCC(O)CO[Si](C(C)C)(C(C)C)C(C)C)cc1OC |
| InChI | InChI=1S/C21H38O5Si/c1-15(2)27(16(3)4,17(5)6)26-14-19(22)13-25-12-18-9-10-20(23-7)21(11-18)24-8/h9-11,15-17,19,22H,12-14H2,1-8H3 |
| InChIKey | CQKWJWVVNXQTBC-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.62 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|