C16H25NO5 — CID 2769761
1-[(3,4-dimethoxyphenyl)methoxy]-3-morpholin-4-ylpropan-2-ol (PubChem CID 2769761) has the molecular formula C16H25NO5 and a molecular weight of 311.38 g/mol. Its IUPAC name is 1-[(3,4-dimethoxyphenyl)methoxy]-3-morpholin-4-ylpropan-2-ol.
| Compound Name | 1-[(3,4-dimethoxyphenyl)methoxy]-3-morpholin-4-ylpropan-2-ol |
|---|---|
| PubChem CID | 2769761 |
| Molecular Formula | C16H25NO5 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | 1-[(3,4-dimethoxyphenyl)methoxy]-3-morpholin-4-ylpropan-2-ol |
| SMILES | COc1ccc(COCC(O)CN2CCOCC2)cc1OC |
| InChI | InChI=1S/C16H25NO5/c1-19-15-4-3-13(9-16(15)20-2)11-22-12-14(18)10-17-5-7-21-8-6-17/h3-4,9,14,18H,5-8,10-12H2,1-2H3 |
| InChIKey | MABSQKAHKUSDJJ-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |