C16H10N4O9 — CID 98538931
(2R)-2-[(E)-(2,4,7-trinitrofluoren-9-ylidene)amino]oxypropanoic acid (PubChem CID 98538931) has the molecular formula C16H10N4O9 and a molecular weight of 402.28 g/mol. Its IUPAC name is (2R)-2-[(E)-(2,4,7-trinitrofluoren-9-ylidene)amino]oxypropanoic acid.
| Compound Name | (2R)-2-[(E)-(2,4,7-trinitrofluoren-9-ylidene)amino]oxypropanoic acid |
|---|---|
| PubChem CID | 98538931 |
| Molecular Formula | C16H10N4O9 |
| Molecular Weight | 402.28 g/mol |
| Exact Mass | 402.04 |
| IUPAC Name | (2R)-2-[(E)-(2,4,7-trinitrofluoren-9-ylidene)amino]oxypropanoic acid |
| SMILES | C[C@@H](O/N=C1\c2cc([N+](=O)[O-])ccc2-c2c1cc([N+](=O)[O-])cc2[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C16H10N4O9/c1-7(16(21)22)29-17-15-11-4-8(18(23)24)2-3-10(11)14-12(15)5-9(19(25)26)6-13(14)20(27)28/h2-7H,1H3,(H,21,22)/b17-15+/t7-/m1/s1 |
| InChIKey | QVUKDFLCLHHSTK-OWJNVRHESA-N |
| XLogP | 2.63 |
| TPSA | 188.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.28 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|