C21H12N4O4 — CID 59944968
3-[(7-methyl-2,4-dinitrofluoren-9-ylidene)amino]benzonitrile (PubChem CID 59944968) has the molecular formula C21H12N4O4 and a molecular weight of 384.35 g/mol. Its IUPAC name is 3-[(7-methyl-2,4-dinitrofluoren-9-ylidene)amino]benzonitrile.
| Compound Name | 3-[(7-methyl-2,4-dinitrofluoren-9-ylidene)amino]benzonitrile |
|---|---|
| PubChem CID | 59944968 |
| Molecular Formula | C21H12N4O4 |
| Molecular Weight | 384.35 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | 3-[(7-methyl-2,4-dinitrofluoren-9-ylidene)amino]benzonitrile |
| SMILES | Cc1ccc2c(c1)/C(=N\c1cccc(C#N)c1)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1-2 |
| InChI | InChI=1S/C21H12N4O4/c1-12-5-6-16-17(7-12)21(23-14-4-2-3-13(8-14)11-22)18-9-15(24(26)27)10-19(20(16)18)25(28)29/h2-10H,1H3/b23-21+ |
| InChIKey | VVYKQAPPYCPUEY-XTQSDGFTSA-N |
| XLogP | 4.83 |
| TPSA | 122.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.35 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|