C21H14N4O6 — CID 10047609
N-(2-ethylphenyl)-2,4,7-trinitrofluoren-9-imine (PubChem CID 10047609) has the molecular formula C21H14N4O6 and a molecular weight of 418.37 g/mol. Its IUPAC name is N-(2-ethylphenyl)-2,4,7-trinitrofluoren-9-imine.
| Compound Name | N-(2-ethylphenyl)-2,4,7-trinitrofluoren-9-imine |
|---|---|
| PubChem CID | 10047609 |
| Molecular Formula | C21H14N4O6 |
| Molecular Weight | 418.37 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | N-(2-ethylphenyl)-2,4,7-trinitrofluoren-9-imine |
| SMILES | CCc1ccccc1/N=C1\c2cc([N+](=O)[O-])ccc2-c2c1cc([N+](=O)[O-])cc2[N+](=O)[O-] |
| InChI | InChI=1S/C21H14N4O6/c1-2-12-5-3-4-6-18(12)22-21-16-9-13(23(26)27)7-8-15(16)20-17(21)10-14(24(28)29)11-19(20)25(30)31/h3-11H,2H2,1H3/b22-21+ |
| InChIKey | NGZDLENDIZDKJC-QURGRASLSA-N |
| XLogP | 5.12 |
| TPSA | 141.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.37 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|