C18H9N3O7 — CID 6510728
2-[(E)-(2,4,7-trinitrofluoren-9-ylidene)methyl]furan (PubChem CID 6510728) has the molecular formula C18H9N3O7 and a molecular weight of 379.28 g/mol. Its IUPAC name is 2-[(E)-(2,4,7-trinitrofluoren-9-ylidene)methyl]furan.
| Compound Name | 2-[(E)-(2,4,7-trinitrofluoren-9-ylidene)methyl]furan |
|---|---|
| PubChem CID | 6510728 |
| Molecular Formula | C18H9N3O7 |
| Molecular Weight | 379.28 g/mol |
| Exact Mass | 379.04 |
| IUPAC Name | 2-[(E)-(2,4,7-trinitrofluoren-9-ylidene)methyl]furan |
| SMILES | O=[N+]([O-])c1ccc2c(c1)/C(=C\c1ccco1)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1-2 |
| InChI | InChI=1S/C18H9N3O7/c22-19(23)10-3-4-13-14(6-10)15(9-12-2-1-5-28-12)16-7-11(20(24)25)8-17(18(13)16)21(26)27/h1-9H/b15-9+ |
| InChIKey | HKIYNAFPKNXQMY-OQLLNIDSSA-N |
| XLogP | 4.57 |
| TPSA | 142.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.28 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|