C26H16N4O7 — CID 59944936
2-methyl-4,5,7-trinitro-N-(2-phenoxyphenyl)fluoren-9-imine (PubChem CID 59944936) has the molecular formula C26H16N4O7 and a molecular weight of 496.44 g/mol. Its IUPAC name is 2-methyl-4,5,7-trinitro-N-(2-phenoxyphenyl)fluoren-9-imine.
| Compound Name | 2-methyl-4,5,7-trinitro-N-(2-phenoxyphenyl)fluoren-9-imine |
|---|---|
| PubChem CID | 59944936 |
| Molecular Formula | C26H16N4O7 |
| Molecular Weight | 496.44 g/mol |
| Exact Mass | 496.10 |
| IUPAC Name | 2-methyl-4,5,7-trinitro-N-(2-phenoxyphenyl)fluoren-9-imine |
| SMILES | Cc1cc2c(c([N+](=O)[O-])c1)-c1c(cc([N+](=O)[O-])cc1[N+](=O)[O-])/C2=N/c1ccccc1Oc1ccccc1 |
| InChI | InChI=1S/C26H16N4O7/c1-15-11-18-24(21(12-15)29(33)34)25-19(13-16(28(31)32)14-22(25)30(35)36)26(18)27-20-9-5-6-10-23(20)37-17-7-3-2-4-8-17/h2-14H,1H3/b27-26+ |
| InChIKey | BREOCGLPKJVDKK-CYYJNZCTSA-N |
| XLogP | 6.66 |
| TPSA | 151.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.44 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|