C12H11F2NO5 — CID 124518473
ethyl (2R)-2-(2,3-difluoro-6-nitrophenyl)-3-oxobutanoate (PubChem CID 124518473) has the molecular formula C12H11F2NO5 and a molecular weight of 287.22 g/mol. Its IUPAC name is ethyl (2R)-2-(2,3-difluoro-6-nitrophenyl)-3-oxobutanoate.
| Compound Name | ethyl (2R)-2-(2,3-difluoro-6-nitrophenyl)-3-oxobutanoate |
|---|---|
| PubChem CID | 124518473 |
| Molecular Formula | C12H11F2NO5 |
| Molecular Weight | 287.22 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | ethyl (2R)-2-(2,3-difluoro-6-nitrophenyl)-3-oxobutanoate |
| SMILES | CCOC(=O)[C@@H](C(C)=O)c1c([N+](=O)[O-])ccc(F)c1F |
| InChI | InChI=1S/C12H11F2NO5/c1-3-20-12(17)9(6(2)16)10-8(15(18)19)5-4-7(13)11(10)14/h4-5,9H,3H2,1-2H3/t9-/m0/s1 |
| InChIKey | MUADLTCJSNZNAN-VIFPVBQESA-N |
| XLogP | 2.11 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.22 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|