C19H24N2O5 — CID 23300603
4-hexoxy-1-methyl-7-nitro-3-prop-2-enoxyquinolin-2-one (PubChem CID 23300603) has the molecular formula C19H24N2O5 and a molecular weight of 360.41 g/mol. Its IUPAC name is 4-hexoxy-1-methyl-7-nitro-3-prop-2-enoxyquinolin-2-one.
| Compound Name | 4-hexoxy-1-methyl-7-nitro-3-prop-2-enoxyquinolin-2-one |
|---|---|
| PubChem CID | 23300603 |
| Molecular Formula | C19H24N2O5 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | 4-hexoxy-1-methyl-7-nitro-3-prop-2-enoxyquinolin-2-one |
| SMILES | C=CCOc1c(OCCCCCC)c2ccc([N+](=O)[O-])cc2n(C)c1=O |
| InChI | InChI=1S/C19H24N2O5/c1-4-6-7-8-12-26-17-15-10-9-14(21(23)24)13-16(15)20(3)19(22)18(17)25-11-5-2/h5,9-10,13H,2,4,6-8,11-12H2,1,3H3 |
| InChIKey | SEQAHLWCCPKQAU-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 83.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|