C10H15NO7PS+ — CID 172785171
(2,3-diethoxy-4-nitrophenyl)-(trihydroxy-λ5-phosphanylidene)sulfanium (PubChem CID 172785171) has the molecular formula C10H15NO7PS+ and a molecular weight of 324.27 g/mol. Its IUPAC name is (2,3-diethoxy-4-nitrophenyl)-(trihydroxy-λ5-phosphanylidene)sulfanium.
| Compound Name | (2,3-diethoxy-4-nitrophenyl)-(trihydroxy-λ5-phosphanylidene)sulfanium |
|---|---|
| PubChem CID | 172785171 |
| Molecular Formula | C10H15NO7PS+ |
| Molecular Weight | 324.27 g/mol |
| Exact Mass | 324.03 |
| IUPAC Name | (2,3-diethoxy-4-nitrophenyl)-(trihydroxy-λ5-phosphanylidene)sulfanium |
| SMILES | CCOc1c([S+]=P(O)(O)O)ccc([N+](=O)[O-])c1OCC |
| InChI | InChI=1S/C10H15NO7PS/c1-3-17-9-7(11(12)13)5-6-8(10(9)18-4-2)20-19(14,15)16/h5-6,14-16H,3-4H2,1-2H3/q+1 |
| InChIKey | RYMBFRQRQKZNQW-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 122.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.27 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|