C15H16N2O9 — CID 175023521
(2,3-diethoxy-4-nitrophenyl) hydrogen carbonate;pyrrole-2,5-dione (PubChem CID 175023521) has the molecular formula C15H16N2O9 and a molecular weight of 368.30 g/mol. Its IUPAC name is (2,3-diethoxy-4-nitrophenyl) hydrogen carbonate;pyrrole-2,5-dione.
| Compound Name | (2,3-diethoxy-4-nitrophenyl) hydrogen carbonate;pyrrole-2,5-dione |
|---|---|
| PubChem CID | 175023521 |
| Molecular Formula | C15H16N2O9 |
| Molecular Weight | 368.30 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | (2,3-diethoxy-4-nitrophenyl) hydrogen carbonate;pyrrole-2,5-dione |
| SMILES | CCOc1c(OC(=O)O)ccc([N+](=O)[O-])c1OCC.O=C1C=CC(=O)N1 |
| InChI | InChI=1S/C11H13NO7.C4H3NO2/c1-3-17-9-7(12(15)16)5-6-8(19-11(13)14)10(9)18-4-2;6-3-1-2-4(7)5-3/h5-6H,3-4H2,1-2H3,(H,13,14);1-2H,(H,5,6,7) |
| InChIKey | URIRSUGLAIAOLQ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 154.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.30 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|