(2,3-diethoxy-4-nitrophenyl) hydrogen carbonate;pyrrole-2,5-dione

C15H16N2O9 — CID 175023521

IUPAC(2,3-diethoxy-4-nitrophenyl) hydrogen carbonate;pyrrole-2,5-dione
SMILESCCOc1c(OC(=O)O)ccc([N+](=O)[O-])c1OCC.O=C1C=CC(=O)N1
InChIInChI=1S/C11H13NO7.C4H3NO2/c1-3-17-9-7(12(15)16)5-6-8(19-11(13)14)10(9)18-4-2;6-3-1-2-4(7)5-3/h5-6H,3-4H2,1-2H3,(H,13,14);1-2H,(H,5,6,7)
InChIKeyURIRSUGLAIAOLQ-UHFFFAOYSA-N
MW368.30 g/mol
LogP1.65
Rot. Bonds6

About (2,3-diethoxy-4-nitrophenyl) hydrogen carbonate;pyrrole-2,5-dione

(2,3-diethoxy-4-nitrophenyl) hydrogen carbonate;pyrrole-2,5-dione (PubChem CID 175023521) has the molecular formula C15H16N2O9 and a molecular weight of 368.30 g/mol. Its IUPAC name is (2,3-diethoxy-4-nitrophenyl) hydrogen carbonate;pyrrole-2,5-dione.

Molecular Properties

Compound Name(2,3-diethoxy-4-nitrophenyl) hydrogen carbonate;pyrrole-2,5-dione
PubChem CID175023521
Molecular FormulaC15H16N2O9
Molecular Weight368.30 g/mol
Exact Mass368.09
IUPAC Name(2,3-diethoxy-4-nitrophenyl) hydrogen carbonate;pyrrole-2,5-dione
SMILESCCOc1c(OC(=O)O)ccc([N+](=O)[O-])c1OCC.O=C1C=CC(=O)N1
InChIInChI=1S/C11H13NO7.C4H3NO2/c1-3-17-9-7(12(15)16)5-6-8(19-11(13)14)10(9)18-4-2;6-3-1-2-4(7)5-3/h5-6H,3-4H2,1-2H3,(H,13,14);1-2H,(H,5,6,7)
InChIKeyURIRSUGLAIAOLQ-UHFFFAOYSA-N
XLogP1.65
TPSA154.30 Ų
H-Bond Donors2
H-Bond Acceptors8
Rotatable Bonds6
Heavy Atoms26
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500368.30
LogP ≤ 51.65
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 108

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}

Analyze (2,3-diethoxy-4-nitrophenyl) hydrogen carbonate;pyrrole-2,5-dione with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2,3-diethoxy-4-nitrophenyl) hydrogen carbonate;pyrrole-2,5-dione?
The IUPAC name of (2,3-diethoxy-4-nitrophenyl) hydrogen carbonate;pyrrole-2,5-dione (CID 175023521) is (2,3-diethoxy-4-nitrophenyl) hydrogen carbonate;pyrrole-2,5-dione.
What is the SMILES notation for (2,3-diethoxy-4-nitrophenyl) hydrogen carbonate;pyrrole-2,5-dione?
The canonical SMILES for (2,3-diethoxy-4-nitrophenyl) hydrogen carbonate;pyrrole-2,5-dione is CCOc1c(OC(=O)O)ccc([N+](=O)[O-])c1OCC.O=C1C=CC(=O)N1.
What is the InChIKey of (2,3-diethoxy-4-nitrophenyl) hydrogen carbonate;pyrrole-2,5-dione?
The InChIKey is URIRSUGLAIAOLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO7.C4H3NO2/c1-3-17-9-7(12(15)16)5-6-8(19-11(13)14)10(9)18-4-2;6-3-1-2-4(7)5-3/h5-6H,3-4H2,1-2H3,(H,13,14);1-2H,(H,5,6,7).
What are the key properties of (2,3-diethoxy-4-nitrophenyl) hydrogen carbonate;pyrrole-2,5-dione?
(2,3-diethoxy-4-nitrophenyl) hydrogen carbonate;pyrrole-2,5-dione has a molecular weight of 368.30 g/mol, XLogP of 1.65, 6 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (2,3-diethoxy-4-nitrophenyl) hydrogen carbonate;pyrrole-2,5-dione is sourced from PubChem (CID 175023521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).