C14F22I+ — CID 87467530
1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl-(2,3,4,5,6-pentafluorophenyl)iodanium (PubChem CID 87467530) has the molecular formula C14F22I+ and a molecular weight of 713.01 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl-(2,3,4,5,6-pentafluorophenyl)iodanium.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl-(2,3,4,5,6-pentafluorophenyl)iodanium |
|---|---|
| PubChem CID | 87467530 |
| Molecular Formula | C14F22I+ |
| Molecular Weight | 713.01 g/mol |
| Exact Mass | 712.87 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl-(2,3,4,5,6-pentafluorophenyl)iodanium |
| SMILES | Fc1c(F)c(F)c([I+]C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C14F22I/c15-1-2(16)4(18)6(5(19)3(1)17)37-14(35,36)12(30,31)10(26,27)8(22,23)7(20,21)9(24,25)11(28,29)13(32,33)34/q+1 |
| InChIKey | NOQWLBGLWVSZJV-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.01 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|