C12HF18IO4S — CID 88736484
hydrogen sulfate;(2,3,4,5,6-pentafluorophenyl)-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)iodanium (PubChem CID 88736484) has the molecular formula C12HF18IO4S and a molecular weight of 710.07 g/mol. Its IUPAC name is hydrogen sulfate;(2,3,4,5,6-pentafluorophenyl)-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)iodanium.
| Compound Name | hydrogen sulfate;(2,3,4,5,6-pentafluorophenyl)-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)iodanium |
|---|---|
| PubChem CID | 88736484 |
| Molecular Formula | C12HF18IO4S |
| Molecular Weight | 710.07 g/mol |
| Exact Mass | 709.84 |
| IUPAC Name | hydrogen sulfate;(2,3,4,5,6-pentafluorophenyl)-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)iodanium |
| SMILES | Fc1c(F)c(F)c([I+]C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c(F)c1F.O=S(=O)([O-])O |
| InChI | InChI=1S/C12F18I.H2O4S/c13-1-2(14)4(16)6(5(17)3(1)15)31-12(29,30)10(24,25)8(20,21)7(18,19)9(22,23)11(26,27)28;1-5(2,3)4/h;(H2,1,2,3,4)/q+1;/p-1 |
| InChIKey | JQXHQBLYTJGXOC-UHFFFAOYSA-M |
| XLogP | 2.34 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.07 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|