C18H15F9O4S2 — CID 59584293
1-fluoro-3-[(2,3,4,5,6-pentafluorophenyl)-(trifluoromethylsulfonyl)methyl]sulfonyladamantane (PubChem CID 59584293) has the molecular formula C18H15F9O4S2 and a molecular weight of 530.43 g/mol. Its IUPAC name is 1-fluoro-3-[(2,3,4,5,6-pentafluorophenyl)-(trifluoromethylsulfonyl)methyl]sulfonyladamantane.
| Compound Name | 1-fluoro-3-[(2,3,4,5,6-pentafluorophenyl)-(trifluoromethylsulfonyl)methyl]sulfonyladamantane |
|---|---|
| PubChem CID | 59584293 |
| Molecular Formula | C18H15F9O4S2 |
| Molecular Weight | 530.43 g/mol |
| Exact Mass | 530.03 |
| IUPAC Name | 1-fluoro-3-[(2,3,4,5,6-pentafluorophenyl)-(trifluoromethylsulfonyl)methyl]sulfonyladamantane |
| SMILES | O=S(=O)(C(c1c(F)c(F)c(F)c(F)c1F)S(=O)(=O)C12CC3CC(CC(F)(C3)C1)C2)C(F)(F)F |
| InChI | InChI=1S/C18H15F9O4S2/c19-10-9(11(20)13(22)14(23)12(10)21)15(33(30,31)18(25,26)27)32(28,29)17-4-7-1-8(5-17)3-16(24,2-7)6-17/h7-8,15H,1-6H2 |
| InChIKey | NFRMYZSECYEBPD-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.43 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|