C14H18F4O2 — CID 175603286
1-fluoro-3-(trifluoromethyl)adamantane;prop-2-enoic acid (PubChem CID 175603286) has the molecular formula C14H18F4O2 and a molecular weight of 294.29 g/mol. Its IUPAC name is 1-fluoro-3-(trifluoromethyl)adamantane;prop-2-enoic acid.
| Compound Name | 1-fluoro-3-(trifluoromethyl)adamantane;prop-2-enoic acid |
|---|---|
| PubChem CID | 175603286 |
| Molecular Formula | C14H18F4O2 |
| Molecular Weight | 294.29 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 1-fluoro-3-(trifluoromethyl)adamantane;prop-2-enoic acid |
| SMILES | C=CC(=O)O.FC12CC3CC(C1)CC(C(F)(F)F)(C3)C2 |
| InChI | InChI=1S/C11H14F4.C3H4O2/c12-10-4-7-1-8(5-10)3-9(2-7,6-10)11(13,14)15;1-2-3(4)5/h7-8H,1-6H2;2H,1H2,(H,4,5) |
| InChIKey | QAYBLQUMRDJJMD-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.29 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|