C10H14FNO2 — CID 68714061
(1-fluoro-3-tricyclo[3.3.1.03,7]nonanyl)carbamic acid (PubChem CID 68714061) has the molecular formula C10H14FNO2 and a molecular weight of 199.22 g/mol. Its IUPAC name is (1-fluoro-3-tricyclo[3.3.1.03,7]nonanyl)carbamic acid.
| Compound Name | (1-fluoro-3-tricyclo[3.3.1.03,7]nonanyl)carbamic acid |
|---|---|
| PubChem CID | 68714061 |
| Molecular Formula | C10H14FNO2 |
| Molecular Weight | 199.22 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | (1-fluoro-3-tricyclo[3.3.1.03,7]nonanyl)carbamic acid |
| SMILES | O=C(O)NC12CC3CC1CC(F)(C3)C2 |
| InChI | InChI=1S/C10H14FNO2/c11-9-2-6-1-7(4-9)10(3-6,5-9)12-8(13)14/h6-7,12H,1-5H2,(H,13,14) |
| InChIKey | USZDDKYBOFRGLY-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.22 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |