About [1-(hydroxymethyl)-3-tricyclo[3.3.1.03,7]nonanyl]carbamic acid
[1-(hydroxymethyl)-3-tricyclo[3.3.1.03,7]nonanyl]carbamic acid (PubChem CID 141189897) has the molecular formula C11H17NO3
and a molecular weight of 211.26 g/mol. Its IUPAC name is [1-(hydroxymethyl)-3-tricyclo[3.3.1.03,7]nonanyl]carbamic acid.
Analyze [1-(hydroxymethyl)-3-tricyclo[3.3.1.03,7]nonanyl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(hydroxymethyl)-3-tricyclo[3.3.1.03,7]nonanyl]carbamic acid?
The IUPAC name of [1-(hydroxymethyl)-3-tricyclo[3.3.1.03,7]nonanyl]carbamic acid (CID 141189897) is [1-(hydroxymethyl)-3-tricyclo[3.3.1.03,7]nonanyl]carbamic acid.
What is the SMILES notation for [1-(hydroxymethyl)-3-tricyclo[3.3.1.03,7]nonanyl]carbamic acid?
The canonical SMILES for [1-(hydroxymethyl)-3-tricyclo[3.3.1.03,7]nonanyl]carbamic acid is O=C(O)NC12CC3CC1CC(CO)(C3)C2.
What is the InChIKey of [1-(hydroxymethyl)-3-tricyclo[3.3.1.03,7]nonanyl]carbamic acid?
The InChIKey is SPBAKGYJYSZNSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO3/c13-6-10-2-7-1-8(4-10)11(3-7,5-10)12-9(14)15/h7-8,12-13H,1-6H2,(H,14,15).
What are the key properties of [1-(hydroxymethyl)-3-tricyclo[3.3.1.03,7]nonanyl]carbamic acid?
[1-(hydroxymethyl)-3-tricyclo[3.3.1.03,7]nonanyl]carbamic acid has a molecular weight of 211.26 g/mol, XLogP of 1.20, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(hydroxymethyl)-3-tricyclo[3.3.1.03,7]nonanyl]carbamic acid is sourced from PubChem (CID 141189897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).