C16H25N5O2 — CID 131739688
butyl N-[1-(tetrazol-1-ylmethyl)-3-tricyclo[3.3.1.03,7]nonanyl]carbamate (PubChem CID 131739688) has the molecular formula C16H25N5O2 and a molecular weight of 319.41 g/mol. Its IUPAC name is butyl N-[1-(tetrazol-1-ylmethyl)-3-tricyclo[3.3.1.03,7]nonanyl]carbamate.
| Compound Name | butyl N-[1-(tetrazol-1-ylmethyl)-3-tricyclo[3.3.1.03,7]nonanyl]carbamate |
|---|---|
| PubChem CID | 131739688 |
| Molecular Formula | C16H25N5O2 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | butyl N-[1-(tetrazol-1-ylmethyl)-3-tricyclo[3.3.1.03,7]nonanyl]carbamate |
| SMILES | CCCCOC(=O)NC12CC3CC1CC(Cn1cnnn1)(C3)C2 |
| InChI | InChI=1S/C16H25N5O2/c1-2-3-4-23-14(22)18-16-7-12-5-13(16)8-15(6-12,9-16)10-21-11-17-19-20-21/h11-13H,2-10H2,1H3,(H,18,22) |
| InChIKey | RGLCQNFPXZVWKD-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|