C16H23BrO5 — CID 87180153
[3-(hydroxymethyl)-1-adamantyl]methyl 2-(2-bromoacetyl)oxyacetate (PubChem CID 87180153) has the molecular formula C16H23BrO5 and a molecular weight of 375.26 g/mol. Its IUPAC name is [3-(hydroxymethyl)-1-adamantyl]methyl 2-(2-bromoacetyl)oxyacetate.
| Compound Name | [3-(hydroxymethyl)-1-adamantyl]methyl 2-(2-bromoacetyl)oxyacetate |
|---|---|
| PubChem CID | 87180153 |
| Molecular Formula | C16H23BrO5 |
| Molecular Weight | 375.26 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | [3-(hydroxymethyl)-1-adamantyl]methyl 2-(2-bromoacetyl)oxyacetate |
| SMILES | O=C(CBr)OCC(=O)OCC12CC3CC(CC(CO)(C3)C1)C2 |
| InChI | InChI=1S/C16H23BrO5/c17-6-13(19)21-7-14(20)22-10-16-4-11-1-12(5-16)3-15(2-11,8-16)9-18/h11-12,18H,1-10H2 |
| InChIKey | AJZLQCRBRZYJLN-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.26 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|